About (E,2S)-7,7-dimethoxy-2-phenylmethoxyhept-4-en-3-one
(E,2S)-7,7-dimethoxy-2-phenylmethoxyhept-4-en-3-one (PubChem CID 24747712) has the molecular formula C16H22O4
and a molecular weight of 278.35 g/mol. Its IUPAC name is (E,2S)-7,7-dimethoxy-2-phenylmethoxyhept-4-en-3-one.
Molecular Properties
| Compound Name | (E,2S)-7,7-dimethoxy-2-phenylmethoxyhept-4-en-3-one |
| PubChem CID | 24747712 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (E,2S)-7,7-dimethoxy-2-phenylmethoxyhept-4-en-3-one |
| SMILES | COC(C/C=C/C(=O)[C@H](C)OCc1ccccc1)OC |
| InChI | InChI=1S/C16H22O4/c1-13(20-12-14-8-5-4-6-9-14)15(17)10-7-11-16(18-2)19-3/h4-10,13,16H,11-12H2,1-3H3/b10-7+/t13-/m0/s1 |
| InChIKey | MJRCIFPARVXQPC-RSPDNQDQSA-N |
| XLogP | 2.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E,2S)-7,7-dimethoxy-2-phenylmethoxyhept-4-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,2S)-7,7-dimethoxy-2-phenylmethoxyhept-4-en-3-one?
The IUPAC name of (E,2S)-7,7-dimethoxy-2-phenylmethoxyhept-4-en-3-one (CID 24747712) is (E,2S)-7,7-dimethoxy-2-phenylmethoxyhept-4-en-3-one.
What is the SMILES notation for (E,2S)-7,7-dimethoxy-2-phenylmethoxyhept-4-en-3-one?
The canonical SMILES for (E,2S)-7,7-dimethoxy-2-phenylmethoxyhept-4-en-3-one is COC(C/C=C/C(=O)[C@H](C)OCc1ccccc1)OC.
What is the InChIKey of (E,2S)-7,7-dimethoxy-2-phenylmethoxyhept-4-en-3-one?
The InChIKey is MJRCIFPARVXQPC-RSPDNQDQSA-N. The full InChI is InChI=1S/C16H22O4/c1-13(20-12-14-8-5-4-6-9-14)15(17)10-7-11-16(18-2)19-3/h4-10,13,16H,11-12H2,1-3H3/b10-7+/t13-/m0/s1.
What are the key properties of (E,2S)-7,7-dimethoxy-2-phenylmethoxyhept-4-en-3-one?
(E,2S)-7,7-dimethoxy-2-phenylmethoxyhept-4-en-3-one has a molecular weight of 278.35 g/mol, XLogP of 2.73, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E,2S)-7,7-dimethoxy-2-phenylmethoxyhept-4-en-3-one is sourced from PubChem (CID 24747712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).