C16H24O4 — CID 24747716
(E,2S,3R)-7,7-dimethoxy-2-phenylmethoxyhept-4-en-3-ol (PubChem CID 24747716) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (E,2S,3R)-7,7-dimethoxy-2-phenylmethoxyhept-4-en-3-ol.
| Compound Name | (E,2S,3R)-7,7-dimethoxy-2-phenylmethoxyhept-4-en-3-ol |
|---|---|
| PubChem CID | 24747716 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (E,2S,3R)-7,7-dimethoxy-2-phenylmethoxyhept-4-en-3-ol |
| SMILES | COC(C/C=C/[C@@H](O)[C@H](C)OCc1ccccc1)OC |
| InChI | InChI=1S/C16H24O4/c1-13(20-12-14-8-5-4-6-9-14)15(17)10-7-11-16(18-2)19-3/h4-10,13,15-17H,11-12H2,1-3H3/b10-7+/t13-,15+/m0/s1 |
| InChIKey | VQFCTNUGJJZSHM-WOPSIANGSA-N |
| XLogP | 2.52 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|