C16H26O5 — CID 24747752
(3S,5R,6S)-1,1-dimethoxy-6-phenylmethoxyheptane-3,5-diol (PubChem CID 24747752) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is (3S,5R,6S)-1,1-dimethoxy-6-phenylmethoxyheptane-3,5-diol.
| Compound Name | (3S,5R,6S)-1,1-dimethoxy-6-phenylmethoxyheptane-3,5-diol |
|---|---|
| PubChem CID | 24747752 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | (3S,5R,6S)-1,1-dimethoxy-6-phenylmethoxyheptane-3,5-diol |
| SMILES | COC(C[C@@H](O)C[C@@H](O)[C@H](C)OCc1ccccc1)OC |
| InChI | InChI=1S/C16H26O5/c1-12(21-11-13-7-5-4-6-8-13)15(18)9-14(17)10-16(19-2)20-3/h4-8,12,14-18H,9-11H2,1-3H3/t12-,14-,15+/m0/s1 |
| InChIKey | WFBQEQDZCXOJBE-AEGPPILISA-N |
| XLogP | 1.71 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|