About 7-(1H-indol-5-yl)-2,3-dimethoxythioxanthen-9-one
7-(1H-indol-5-yl)-2,3-dimethoxythioxanthen-9-one (PubChem CID 24747826) has the molecular formula C23H17NO3S
and a molecular weight of 387.46 g/mol. Its IUPAC name is 7-(1H-indol-5-yl)-2,3-dimethoxythioxanthen-9-one.
Molecular Properties
| Compound Name | 7-(1H-indol-5-yl)-2,3-dimethoxythioxanthen-9-one |
| PubChem CID | 24747826 |
| Molecular Formula | C23H17NO3S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 7-(1H-indol-5-yl)-2,3-dimethoxythioxanthen-9-one |
| SMILES | COc1cc2sc3ccc(-c4ccc5[nH]ccc5c4)cc3c(=O)c2cc1OC |
| InChI | InChI=1S/C23H17NO3S/c1-26-19-11-17-22(12-20(19)27-2)28-21-6-4-14(10-16(21)23(17)25)13-3-5-18-15(9-13)7-8-24-18/h3-12,24H,1-2H3 |
| InChIKey | WJKGGTOGXZWIER-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 7-(1H-indol-5-yl)-2,3-dimethoxythioxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1H-indol-5-yl)-2,3-dimethoxythioxanthen-9-one?
The IUPAC name of 7-(1H-indol-5-yl)-2,3-dimethoxythioxanthen-9-one (CID 24747826) is 7-(1H-indol-5-yl)-2,3-dimethoxythioxanthen-9-one.
What is the SMILES notation for 7-(1H-indol-5-yl)-2,3-dimethoxythioxanthen-9-one?
The canonical SMILES for 7-(1H-indol-5-yl)-2,3-dimethoxythioxanthen-9-one is COc1cc2sc3ccc(-c4ccc5[nH]ccc5c4)cc3c(=O)c2cc1OC.
What is the InChIKey of 7-(1H-indol-5-yl)-2,3-dimethoxythioxanthen-9-one?
The InChIKey is WJKGGTOGXZWIER-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17NO3S/c1-26-19-11-17-22(12-20(19)27-2)28-21-6-4-14(10-16(21)23(17)25)13-3-5-18-15(9-13)7-8-24-18/h3-12,24H,1-2H3.
What are the key properties of 7-(1H-indol-5-yl)-2,3-dimethoxythioxanthen-9-one?
7-(1H-indol-5-yl)-2,3-dimethoxythioxanthen-9-one has a molecular weight of 387.46 g/mol, XLogP of 5.58, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1H-indol-5-yl)-2,3-dimethoxythioxanthen-9-one is sourced from PubChem (CID 24747826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).