C23H17NO3S — CID 24747826
7-(1H-indol-5-yl)-2,3-dimethoxythioxanthen-9-one (PubChem CID 24747826) has the molecular formula C23H17NO3S and a molecular weight of 387.46 g/mol. Its IUPAC name is 7-(1H-indol-5-yl)-2,3-dimethoxythioxanthen-9-one.
| Compound Name | 7-(1H-indol-5-yl)-2,3-dimethoxythioxanthen-9-one |
|---|---|
| PubChem CID | 24747826 |
| Molecular Formula | C23H17NO3S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 7-(1H-indol-5-yl)-2,3-dimethoxythioxanthen-9-one |
| SMILES | COc1cc2sc3ccc(-c4ccc5[nH]ccc5c4)cc3c(=O)c2cc1OC |
| InChI | InChI=1S/C23H17NO3S/c1-26-19-11-17-22(12-20(19)27-2)28-21-6-4-14(10-16(21)23(17)25)13-3-5-18-15(9-13)7-8-24-18/h3-12,24H,1-2H3 |
| InChIKey | WJKGGTOGXZWIER-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|