C26H20O3S — CID 24747884
3,5-bis(4-methoxyphenyl)-2-thiophen-3-yl-1-benzofuran (PubChem CID 24747884) has the molecular formula C26H20O3S and a molecular weight of 412.51 g/mol. Its IUPAC name is 3,5-bis(4-methoxyphenyl)-2-thiophen-3-yl-1-benzofuran.
| Compound Name | 3,5-bis(4-methoxyphenyl)-2-thiophen-3-yl-1-benzofuran |
|---|---|
| PubChem CID | 24747884 |
| Molecular Formula | C26H20O3S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 3,5-bis(4-methoxyphenyl)-2-thiophen-3-yl-1-benzofuran |
| SMILES | COc1ccc(-c2ccc3oc(-c4ccsc4)c(-c4ccc(OC)cc4)c3c2)cc1 |
| InChI | InChI=1S/C26H20O3S/c1-27-21-8-3-17(4-9-21)19-7-12-24-23(15-19)25(18-5-10-22(28-2)11-6-18)26(29-24)20-13-14-30-16-20/h3-16H,1-2H3 |
| InChIKey | HYXXTWHXXJLILE-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |