About 7-[2-(4-aminophenyl)ethynyl]-2,3-dimethoxyxanthen-9-one
7-[2-(4-aminophenyl)ethynyl]-2,3-dimethoxyxanthen-9-one (PubChem CID 24747928) has the molecular formula C23H17NO4
and a molecular weight of 371.39 g/mol. Its IUPAC name is 7-[2-(4-aminophenyl)ethynyl]-2,3-dimethoxyxanthen-9-one.
Molecular Properties
| Compound Name | 7-[2-(4-aminophenyl)ethynyl]-2,3-dimethoxyxanthen-9-one |
| PubChem CID | 24747928 |
| Molecular Formula | C23H17NO4 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 7-[2-(4-aminophenyl)ethynyl]-2,3-dimethoxyxanthen-9-one |
| SMILES | COc1cc2oc3ccc(C#Cc4ccc(N)cc4)cc3c(=O)c2cc1OC |
| InChI | InChI=1S/C23H17NO4/c1-26-21-12-18-20(13-22(21)27-2)28-19-10-7-15(11-17(19)23(18)25)4-3-14-5-8-16(24)9-6-14/h5-13H,24H2,1-2H3 |
| InChIKey | XHYDPGCZSLHFCS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-[2-(4-aminophenyl)ethynyl]-2,3-dimethoxyxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-(4-aminophenyl)ethynyl]-2,3-dimethoxyxanthen-9-one?
The IUPAC name of 7-[2-(4-aminophenyl)ethynyl]-2,3-dimethoxyxanthen-9-one (CID 24747928) is 7-[2-(4-aminophenyl)ethynyl]-2,3-dimethoxyxanthen-9-one.
What is the SMILES notation for 7-[2-(4-aminophenyl)ethynyl]-2,3-dimethoxyxanthen-9-one?
The canonical SMILES for 7-[2-(4-aminophenyl)ethynyl]-2,3-dimethoxyxanthen-9-one is COc1cc2oc3ccc(C#Cc4ccc(N)cc4)cc3c(=O)c2cc1OC.
What is the InChIKey of 7-[2-(4-aminophenyl)ethynyl]-2,3-dimethoxyxanthen-9-one?
The InChIKey is XHYDPGCZSLHFCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17NO4/c1-26-21-12-18-20(13-22(21)27-2)28-19-10-7-15(11-17(19)23(18)25)4-3-14-5-8-16(24)9-6-14/h5-13H,24H2,1-2H3.
What are the key properties of 7-[2-(4-aminophenyl)ethynyl]-2,3-dimethoxyxanthen-9-one?
7-[2-(4-aminophenyl)ethynyl]-2,3-dimethoxyxanthen-9-one has a molecular weight of 371.39 g/mol, XLogP of 3.95, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-(4-aminophenyl)ethynyl]-2,3-dimethoxyxanthen-9-one is sourced from PubChem (CID 24747928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).