About 6-methyl-1-morpholin-4-yl-2,3-diphenylheptan-3-ol;hydrochloride
6-methyl-1-morpholin-4-yl-2,3-diphenylheptan-3-ol;hydrochloride (PubChem CID 24747974) has the molecular formula C24H34ClNO2
and a molecular weight of 403.99 g/mol. Its IUPAC name is 6-methyl-1-morpholin-4-yl-2,3-diphenylheptan-3-ol;hydrochloride.
Molecular Properties
| Compound Name | 6-methyl-1-morpholin-4-yl-2,3-diphenylheptan-3-ol;hydrochloride |
| PubChem CID | 24747974 |
| Molecular Formula | C24H34ClNO2 |
| Molecular Weight | 403.99 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 6-methyl-1-morpholin-4-yl-2,3-diphenylheptan-3-ol;hydrochloride |
| SMILES | CC(C)CCC(O)(c1ccccc1)C(CN1CCOCC1)c1ccccc1.Cl |
| InChI | InChI=1S/C24H33NO2.ClH/c1-20(2)13-14-24(26,22-11-7-4-8-12-22)23(21-9-5-3-6-10-21)19-25-15-17-27-18-16-25;/h3-12,20,23,26H,13-19H2,1-2H3;1H |
| InChIKey | LZPIDHGYMLOGMN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.99 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-1-morpholin-4-yl-2,3-diphenylheptan-3-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1-morpholin-4-yl-2,3-diphenylheptan-3-ol;hydrochloride?
The IUPAC name of 6-methyl-1-morpholin-4-yl-2,3-diphenylheptan-3-ol;hydrochloride (CID 24747974) is 6-methyl-1-morpholin-4-yl-2,3-diphenylheptan-3-ol;hydrochloride.
What is the SMILES notation for 6-methyl-1-morpholin-4-yl-2,3-diphenylheptan-3-ol;hydrochloride?
The canonical SMILES for 6-methyl-1-morpholin-4-yl-2,3-diphenylheptan-3-ol;hydrochloride is CC(C)CCC(O)(c1ccccc1)C(CN1CCOCC1)c1ccccc1.Cl.
What is the InChIKey of 6-methyl-1-morpholin-4-yl-2,3-diphenylheptan-3-ol;hydrochloride?
The InChIKey is LZPIDHGYMLOGMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33NO2.ClH/c1-20(2)13-14-24(26,22-11-7-4-8-12-22)23(21-9-5-3-6-10-21)19-25-15-17-27-18-16-25;/h3-12,20,23,26H,13-19H2,1-2H3;1H.
What are the key properties of 6-methyl-1-morpholin-4-yl-2,3-diphenylheptan-3-ol;hydrochloride?
6-methyl-1-morpholin-4-yl-2,3-diphenylheptan-3-ol;hydrochloride has a molecular weight of 403.99 g/mol, XLogP of 4.85, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1-morpholin-4-yl-2,3-diphenylheptan-3-ol;hydrochloride is sourced from PubChem (CID 24747974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).