C8H16O8 — CID 24748
acetic acid;2,3,4,5,6-pentahydroxyhexanal (PubChem CID 24748) has the molecular formula C8H16O8 and a molecular weight of 240.21 g/mol. Its IUPAC name is acetic acid;2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | acetic acid;2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 24748 |
| Molecular Formula | C8H16O8 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | acetic acid;2,3,4,5,6-pentahydroxyhexanal |
| SMILES | CC(=O)O.O=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H12O6.C2H4O2/c7-1-3(9)5(11)6(12)4(10)2-8;1-2(3)4/h1,3-6,8-12H,2H2;1H3,(H,3,4) |
| InChIKey | VJHCJDRQFCCTHL-UHFFFAOYSA-N |
| XLogP | -3.29 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|