C20H24N2O5S — CID 24748000
ethyl 1-[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-3-carboxylate (PubChem CID 24748000) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is ethyl 1-[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 24748000 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | ethyl 1-[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C2=NC(=O)/C(=C/c3ccc(OC)cc3OC)S2)C1 |
| InChI | InChI=1S/C20H24N2O5S/c1-4-27-19(24)14-6-5-9-22(12-14)20-21-18(23)17(28-20)10-13-7-8-15(25-2)11-16(13)26-3/h7-8,10-11,14H,4-6,9,12H2,1-3H3/b17-10- |
| InChIKey | DBGHFVAIGPOLJA-YVLHZVERSA-N |
| XLogP | 2.95 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|