C22H22N2O7 — CID 24748044
(4S,4aS,12aR)-4-(dimethylamino)-10,11,12a-trihydroxy-6-methyl-1,3,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide (PubChem CID 24748044) has the molecular formula C22H22N2O7 and a molecular weight of 426.43 g/mol. Its IUPAC name is (4S,4aS,12aR)-4-(dimethylamino)-10,11,12a-trihydroxy-6-methyl-1,3,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,12aR)-4-(dimethylamino)-10,11,12a-trihydroxy-6-methyl-1,3,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 24748044 |
| Molecular Formula | C22H22N2O7 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | (4S,4aS,12aR)-4-(dimethylamino)-10,11,12a-trihydroxy-6-methyl-1,3,12-trioxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
| SMILES | Cc1c2c(c(O)c3c(O)cccc13)C(=O)[C@]1(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]1C2 |
| InChI | InChI=1S/C22H22N2O7/c1-8-9-5-4-6-12(25)13(9)17(26)14-10(8)7-11-16(24(2)3)18(27)15(21(23)30)20(29)22(11,31)19(14)28/h4-6,11,15-16,25-26,31H,7H2,1-3H3,(H2,23,30)/t11-,15?,16-,22-/m0/s1 |
| InChIKey | NHRGMXWZPFNLOB-DGPJRMGOSA-N |
| XLogP | -0.17 |
| TPSA | 158.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|