About 5-amino-1,6,6-triethylpiperidin-3-ol
5-amino-1,6,6-triethylpiperidin-3-ol (PubChem CID 24748227) has the molecular formula C11H24N2O
and a molecular weight of 200.33 g/mol. Its IUPAC name is 5-amino-1,6,6-triethylpiperidin-3-ol.
Molecular Properties
| Compound Name | 5-amino-1,6,6-triethylpiperidin-3-ol |
| PubChem CID | 24748227 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 5-amino-1,6,6-triethylpiperidin-3-ol |
| SMILES | CCN1CC(O)CC(N)C1(CC)CC |
| InChI | InChI=1S/C11H24N2O/c1-4-11(5-2)10(12)7-9(14)8-13(11)6-3/h9-10,14H,4-8,12H2,1-3H3 |
| InChIKey | AMSLFFRQRIWXFF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-amino-1,6,6-triethylpiperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1,6,6-triethylpiperidin-3-ol?
The IUPAC name of 5-amino-1,6,6-triethylpiperidin-3-ol (CID 24748227) is 5-amino-1,6,6-triethylpiperidin-3-ol.
What is the SMILES notation for 5-amino-1,6,6-triethylpiperidin-3-ol?
The canonical SMILES for 5-amino-1,6,6-triethylpiperidin-3-ol is CCN1CC(O)CC(N)C1(CC)CC.
What is the InChIKey of 5-amino-1,6,6-triethylpiperidin-3-ol?
The InChIKey is AMSLFFRQRIWXFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O/c1-4-11(5-2)10(12)7-9(14)8-13(11)6-3/h9-10,14H,4-8,12H2,1-3H3.
What are the key properties of 5-amino-1,6,6-triethylpiperidin-3-ol?
5-amino-1,6,6-triethylpiperidin-3-ol has a molecular weight of 200.33 g/mol, XLogP of 0.96, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,6,6-triethylpiperidin-3-ol is sourced from PubChem (CID 24748227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).