C22H25N3O4 — CID 24748349
1-[5-(2,6-dimethoxypyrimidin-4-yl)-1,3-oxazol-2-yl]-7-phenylheptan-1-one (PubChem CID 24748349) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 1-[5-(2,6-dimethoxypyrimidin-4-yl)-1,3-oxazol-2-yl]-7-phenylheptan-1-one.
| Compound Name | 1-[5-(2,6-dimethoxypyrimidin-4-yl)-1,3-oxazol-2-yl]-7-phenylheptan-1-one |
|---|---|
| PubChem CID | 24748349 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 1-[5-(2,6-dimethoxypyrimidin-4-yl)-1,3-oxazol-2-yl]-7-phenylheptan-1-one |
| SMILES | COc1cc(-c2cnc(C(=O)CCCCCCc3ccccc3)o2)nc(OC)n1 |
| InChI | InChI=1S/C22H25N3O4/c1-27-20-14-17(24-22(25-20)28-2)19-15-23-21(29-19)18(26)13-9-4-3-6-10-16-11-7-5-8-12-16/h5,7-8,11-12,14-15H,3-4,6,9-10,13H2,1-2H3 |
| InChIKey | GZXPZNRGZSEVND-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 87.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|