C35H42Cl2N4O6 — CID 24748376
4-[[(2S,4S)-1-[2-[2,5-dichloro-4-(1H-indole-3-carbonylamino)phenyl]acetyl]-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylic acid (PubChem CID 24748376) has the molecular formula C35H42Cl2N4O6 and a molecular weight of 685.65 g/mol. Its IUPAC name is 4-[[(2S,4S)-1-[2-[2,5-dichloro-4-(1H-indole-3-carbonylamino)phenyl]acetyl]-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(2S,4S)-1-[2-[2,5-dichloro-4-(1H-indole-3-carbonylamino)phenyl]acetyl]-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 24748376 |
| Molecular Formula | C35H42Cl2N4O6 |
| Molecular Weight | 685.65 g/mol |
| Exact Mass | 684.25 |
| IUPAC Name | 4-[[(2S,4S)-1-[2-[2,5-dichloro-4-(1H-indole-3-carbonylamino)phenyl]acetyl]-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrrolidin-2-yl]methoxy]cyclohexane-1-carboxylic acid |
| SMILES | C[C@@H]1CN([C@H]2C[C@@H](COC3CCC(C(=O)O)CC3)N(C(=O)Cc3cc(Cl)c(NC(=O)c4c[nH]c5ccccc45)cc3Cl)C2)C[C@H](C)O1 |
| InChI | InChI=1S/C35H42Cl2N4O6/c1-20-16-40(17-21(2)47-20)24-13-25(19-46-26-9-7-22(8-10-26)35(44)45)41(18-24)33(42)12-23-11-30(37)32(14-29(23)36)39-34(43)28-15-38-31-6-4-3-5-27(28)31/h3-6,11,14-15,20-22,24-26,38H,7-10,12-13,16-19H2,1-2H3,(H,39,43)(H,44,45)/t20-,21+,22?,24-,25-,26?/m0/s1 |
| InChIKey | XWQPSKUILURIQQ-UDOWCGICSA-N |
| XLogP | 6.01 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.65 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |