C28H34F2N4O — CID 24748750
(2R)-2-[(4S)-4-[2-(3,5-difluoro-4-methylphenyl)ethyl]-1-ethyl-3-methyl-4,6,7,8-tetrahydropyrazolo[4,5-c]azepin-5-yl]-N-methyl-2-phenylacetamide (PubChem CID 24748750) has the molecular formula C28H34F2N4O and a molecular weight of 480.60 g/mol. Its IUPAC name is (2R)-2-[(4S)-4-[2-(3,5-difluoro-4-methylphenyl)ethyl]-1-ethyl-3-methyl-4,6,7,8-tetrahydropyrazolo[4,5-c]azepin-5-yl]-N-methyl-2-phenylacetamide.
| Compound Name | (2R)-2-[(4S)-4-[2-(3,5-difluoro-4-methylphenyl)ethyl]-1-ethyl-3-methyl-4,6,7,8-tetrahydropyrazolo[4,5-c]azepin-5-yl]-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 24748750 |
| Molecular Formula | C28H34F2N4O |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | (2R)-2-[(4S)-4-[2-(3,5-difluoro-4-methylphenyl)ethyl]-1-ethyl-3-methyl-4,6,7,8-tetrahydropyrazolo[4,5-c]azepin-5-yl]-N-methyl-2-phenylacetamide |
| SMILES | CCn1nc(C)c2c1CCCN([C@@H](C(=O)NC)c1ccccc1)[C@H]2CCc1cc(F)c(C)c(F)c1 |
| InChI | InChI=1S/C28H34F2N4O/c1-5-34-25-12-9-15-33(27(28(35)31-4)21-10-7-6-8-11-21)24(26(25)19(3)32-34)14-13-20-16-22(29)18(2)23(30)17-20/h6-8,10-11,16-17,24,27H,5,9,12-15H2,1-4H3,(H,31,35)/t24-,27+/m0/s1 |
| InChIKey | BJEYXQMLWATVMU-RPLLCQBOSA-N |
| XLogP | 5.21 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |