C33H30F3N4O7PS — CID 24749066
2-[4-[2-diphenoxyphosphoryl-2-(naphthalen-1-ylsulfonylamino)ethyl]phenyl]guanidine;2,2,2-trifluoroacetic acid (PubChem CID 24749066) has the molecular formula C33H30F3N4O7PS and a molecular weight of 714.66 g/mol. Its IUPAC name is 2-[4-[2-diphenoxyphosphoryl-2-(naphthalen-1-ylsulfonylamino)ethyl]phenyl]guanidine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-[2-diphenoxyphosphoryl-2-(naphthalen-1-ylsulfonylamino)ethyl]phenyl]guanidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24749066 |
| Molecular Formula | C33H30F3N4O7PS |
| Molecular Weight | 714.66 g/mol |
| Exact Mass | 714.15 |
| IUPAC Name | 2-[4-[2-diphenoxyphosphoryl-2-(naphthalen-1-ylsulfonylamino)ethyl]phenyl]guanidine;2,2,2-trifluoroacetic acid |
| SMILES | NC(N)=Nc1ccc(CC(NS(=O)(=O)c2cccc3ccccc23)P(=O)(Oc2ccccc2)Oc2ccccc2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C31H29N4O5PS.C2HF3O2/c32-31(33)34-25-20-18-23(19-21-25)22-30(35-42(37,38)29-17-9-11-24-10-7-8-16-28(24)29)41(36,39-26-12-3-1-4-13-26)40-27-14-5-2-6-15-27;3-2(4,5)1(6)7/h1-21,30,35H,22H2,(H4,32,33,34);(H,6,7) |
| InChIKey | LLPORYGPWGTPDB-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 183.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.66 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|