C28H40N2O2 — CID 24749162
(9Z,12Z,15Z)-N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]octadeca-9,12,15-trienamide (PubChem CID 24749162) has the molecular formula C28H40N2O2 and a molecular weight of 436.64 g/mol. Its IUPAC name is (9Z,12Z,15Z)-N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]octadeca-9,12,15-trienamide.
| Compound Name | (9Z,12Z,15Z)-N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]octadeca-9,12,15-trienamide |
|---|---|
| PubChem CID | 24749162 |
| Molecular Formula | C28H40N2O2 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.31 |
| IUPAC Name | (9Z,12Z,15Z)-N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]octadeca-9,12,15-trienamide |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)NCCc1c[nH]c2ccc(O)cc12 |
| InChI | InChI=1S/C28H40N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-28(32)29-21-20-24-23-30-27-19-18-25(31)22-26(24)27/h3-4,6-7,9-10,18-19,22-23,30-31H,2,5,8,11-17,20-21H2,1H3,(H,29,32)/b4-3-,7-6-,10-9- |
| InChIKey | MAFMPVLBSWXLHL-PDBXOOCHSA-N |
| XLogP | 7.12 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|