C18H23NO3S — CID 24749321
3-[(5S,7aR)-2-(4-methylphenyl)sulfonyl-1,3,5,7a-tetrahydroisoindol-5-yl]propan-1-ol (PubChem CID 24749321) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is 3-[(5S,7aR)-2-(4-methylphenyl)sulfonyl-1,3,5,7a-tetrahydroisoindol-5-yl]propan-1-ol.
| Compound Name | 3-[(5S,7aR)-2-(4-methylphenyl)sulfonyl-1,3,5,7a-tetrahydroisoindol-5-yl]propan-1-ol |
|---|---|
| PubChem CID | 24749321 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 3-[(5S,7aR)-2-(4-methylphenyl)sulfonyl-1,3,5,7a-tetrahydroisoindol-5-yl]propan-1-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3=C[C@@H](CCCO)C=C[C@H]3C2)cc1 |
| InChI | InChI=1S/C18H23NO3S/c1-14-4-8-18(9-5-14)23(21,22)19-12-16-7-6-15(3-2-10-20)11-17(16)13-19/h4-9,11,15-16,20H,2-3,10,12-13H2,1H3/t15-,16-/m0/s1 |
| InChIKey | OKODRSYOIZCLRW-HOTGVXAUSA-N |
| XLogP | 2.50 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|