About 4-methyl-N-[(2R)-3-oxo-2,3-diphenylpropyl]benzenesulfonamide
4-methyl-N-[(2R)-3-oxo-2,3-diphenylpropyl]benzenesulfonamide (PubChem CID 24749451) has the molecular formula C22H21NO3S
and a molecular weight of 379.48 g/mol. Its IUPAC name is 4-methyl-N-[(2R)-3-oxo-2,3-diphenylpropyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-methyl-N-[(2R)-3-oxo-2,3-diphenylpropyl]benzenesulfonamide |
| PubChem CID | 24749451 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 4-methyl-N-[(2R)-3-oxo-2,3-diphenylpropyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC[C@H](C(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21NO3S/c1-17-12-14-20(15-13-17)27(25,26)23-16-21(18-8-4-2-5-9-18)22(24)19-10-6-3-7-11-19/h2-15,21,23H,16H2,1H3/t21-/m0/s1 |
| InChIKey | UITFXKVKDDPRJR-NRFANRHFSA-N |
| XLogP | 3.94 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-N-[(2R)-3-oxo-2,3-diphenylpropyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-[(2R)-3-oxo-2,3-diphenylpropyl]benzenesulfonamide?
The IUPAC name of 4-methyl-N-[(2R)-3-oxo-2,3-diphenylpropyl]benzenesulfonamide (CID 24749451) is 4-methyl-N-[(2R)-3-oxo-2,3-diphenylpropyl]benzenesulfonamide.
What is the SMILES notation for 4-methyl-N-[(2R)-3-oxo-2,3-diphenylpropyl]benzenesulfonamide?
The canonical SMILES for 4-methyl-N-[(2R)-3-oxo-2,3-diphenylpropyl]benzenesulfonamide is Cc1ccc(S(=O)(=O)NC[C@H](C(=O)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 4-methyl-N-[(2R)-3-oxo-2,3-diphenylpropyl]benzenesulfonamide?
The InChIKey is UITFXKVKDDPRJR-NRFANRHFSA-N. The full InChI is InChI=1S/C22H21NO3S/c1-17-12-14-20(15-13-17)27(25,26)23-16-21(18-8-4-2-5-9-18)22(24)19-10-6-3-7-11-19/h2-15,21,23H,16H2,1H3/t21-/m0/s1.
What are the key properties of 4-methyl-N-[(2R)-3-oxo-2,3-diphenylpropyl]benzenesulfonamide?
4-methyl-N-[(2R)-3-oxo-2,3-diphenylpropyl]benzenesulfonamide has a molecular weight of 379.48 g/mol, XLogP of 3.94, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-[(2R)-3-oxo-2,3-diphenylpropyl]benzenesulfonamide is sourced from PubChem (CID 24749451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).