About (3-phenylphenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate
(3-phenylphenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate (PubChem CID 24749587) has the molecular formula C23H20N2O3
and a molecular weight of 372.42 g/mol. Its IUPAC name is (3-phenylphenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate.
Molecular Properties
| Compound Name | (3-phenylphenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate |
| PubChem CID | 24749587 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (3-phenylphenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate |
| SMILES | O=C(NCCc1c[nH]c2ccc(O)cc12)Oc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C23H20N2O3/c26-19-9-10-22-21(14-19)18(15-25-22)11-12-24-23(27)28-20-8-4-7-17(13-20)16-5-2-1-3-6-16/h1-10,13-15,25-26H,11-12H2,(H,24,27) |
| InChIKey | FQAMJVSKMMVDOK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-phenylphenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenylphenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate?
The IUPAC name of (3-phenylphenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate (CID 24749587) is (3-phenylphenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate.
What is the SMILES notation for (3-phenylphenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate?
The canonical SMILES for (3-phenylphenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate is O=C(NCCc1c[nH]c2ccc(O)cc12)Oc1cccc(-c2ccccc2)c1.
What is the InChIKey of (3-phenylphenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate?
The InChIKey is FQAMJVSKMMVDOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N2O3/c26-19-9-10-22-21(14-19)18(15-25-22)11-12-24-23(27)28-20-8-4-7-17(13-20)16-5-2-1-3-6-16/h1-10,13-15,25-26H,11-12H2,(H,24,27).
What are the key properties of (3-phenylphenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate?
(3-phenylphenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate has a molecular weight of 372.42 g/mol, XLogP of 4.87, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenylphenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate is sourced from PubChem (CID 24749587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).