About (3-chlorophenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate
(3-chlorophenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate (PubChem CID 24749590) has the molecular formula C17H15ClN2O3
and a molecular weight of 330.77 g/mol. Its IUPAC name is (3-chlorophenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate.
Molecular Properties
| Compound Name | (3-chlorophenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate |
| PubChem CID | 24749590 |
| Molecular Formula | C17H15ClN2O3 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | (3-chlorophenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate |
| SMILES | O=C(NCCc1c[nH]c2ccc(O)cc12)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H15ClN2O3/c18-12-2-1-3-14(8-12)23-17(22)19-7-6-11-10-20-16-5-4-13(21)9-15(11)16/h1-5,8-10,20-21H,6-7H2,(H,19,22) |
| InChIKey | KHMWONIAKIGLAO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-chlorophenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate?
The IUPAC name of (3-chlorophenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate (CID 24749590) is (3-chlorophenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate.
What is the SMILES notation for (3-chlorophenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate?
The canonical SMILES for (3-chlorophenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate is O=C(NCCc1c[nH]c2ccc(O)cc12)Oc1cccc(Cl)c1.
What is the InChIKey of (3-chlorophenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate?
The InChIKey is KHMWONIAKIGLAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClN2O3/c18-12-2-1-3-14(8-12)23-17(22)19-7-6-11-10-20-16-5-4-13(21)9-15(11)16/h1-5,8-10,20-21H,6-7H2,(H,19,22).
What are the key properties of (3-chlorophenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate?
(3-chlorophenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate has a molecular weight of 330.77 g/mol, XLogP of 3.86, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl) N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate is sourced from PubChem (CID 24749590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).