C25H52OSiSn — CID 24749652
tert-butyl-dimethyl-[(1E,3R,4S)-4-methyl-1-tributylstannylhexa-1,5-dien-3-yl]oxysilane (PubChem CID 24749652) has the molecular formula C25H52OSiSn and a molecular weight of 515.49 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1E,3R,4S)-4-methyl-1-tributylstannylhexa-1,5-dien-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1E,3R,4S)-4-methyl-1-tributylstannylhexa-1,5-dien-3-yl]oxysilane |
|---|---|
| PubChem CID | 24749652 |
| Molecular Formula | C25H52OSiSn |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | tert-butyl-dimethyl-[(1E,3R,4S)-4-methyl-1-tributylstannylhexa-1,5-dien-3-yl]oxysilane |
| SMILES | C=C[C@H](C)[C@H](/C=C/[Sn](CCCC)(CCCC)CCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H25OSi.3C4H9.Sn/c1-9-11(3)12(10-2)14-15(7,8)13(4,5)6;3*1-3-4-2;/h2,9-12H,1H2,3-8H3;3*1,3-4H2,2H3;/t11-,12-;;;;/m0..../s1 |
| InChIKey | GZXRAPBSZCGKAQ-RDKDOERDSA-N |
| XLogP | 9.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|