About 2-(3-pentylphenyl)acetic acid
2-(3-pentylphenyl)acetic acid (PubChem CID 24749700) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 2-(3-pentylphenyl)acetic acid.
Molecular Properties
| Compound Name | 2-(3-pentylphenyl)acetic acid |
| PubChem CID | 24749700 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-(3-pentylphenyl)acetic acid |
| SMILES | CCCCCc1cccc(CC(=O)O)c1 |
| InChI | InChI=1S/C13H18O2/c1-2-3-4-6-11-7-5-8-12(9-11)10-13(14)15/h5,7-9H,2-4,6,10H2,1H3,(H,14,15) |
| InChIKey | PEGQOIGYZLJMIB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-pentylphenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-pentylphenyl)acetic acid?
The IUPAC name of 2-(3-pentylphenyl)acetic acid (CID 24749700) is 2-(3-pentylphenyl)acetic acid.
What is the SMILES notation for 2-(3-pentylphenyl)acetic acid?
The canonical SMILES for 2-(3-pentylphenyl)acetic acid is CCCCCc1cccc(CC(=O)O)c1.
What is the InChIKey of 2-(3-pentylphenyl)acetic acid?
The InChIKey is PEGQOIGYZLJMIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-2-3-4-6-11-7-5-8-12(9-11)10-13(14)15/h5,7-9H,2-4,6,10H2,1H3,(H,14,15).
What are the key properties of 2-(3-pentylphenyl)acetic acid?
2-(3-pentylphenyl)acetic acid has a molecular weight of 206.28 g/mol, XLogP of 3.05, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-pentylphenyl)acetic acid is sourced from PubChem (CID 24749700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).