C18H27NO3 — CID 24749790
(1S,3S,8S,9R,10R,12S)-10-(methoxymethoxy)-5-methyl-5-azatetracyclo[7.7.0.01,12.03,8]hexadec-14-en-16-one (PubChem CID 24749790) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is (1S,3S,8S,9R,10R,12S)-10-(methoxymethoxy)-5-methyl-5-azatetracyclo[7.7.0.01,12.03,8]hexadec-14-en-16-one.
| Compound Name | (1S,3S,8S,9R,10R,12S)-10-(methoxymethoxy)-5-methyl-5-azatetracyclo[7.7.0.01,12.03,8]hexadec-14-en-16-one |
|---|---|
| PubChem CID | 24749790 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | (1S,3S,8S,9R,10R,12S)-10-(methoxymethoxy)-5-methyl-5-azatetracyclo[7.7.0.01,12.03,8]hexadec-14-en-16-one |
| SMILES | COCO[C@@H]1C[C@@H]2CC=CC(=O)[C@@]23C[C@@H]2CN(C)CC[C@@H]2[C@@H]13 |
| InChI | InChI=1S/C18H27NO3/c1-19-7-6-14-12(10-19)9-18-13(4-3-5-16(18)20)8-15(17(14)18)22-11-21-2/h3,5,12-15,17H,4,6-11H2,1-2H3/t12-,13+,14+,15-,17+,18-/m1/s1 |
| InChIKey | YUQPSLOFGFFULP-IAEPDVJVSA-N |
| XLogP | 2.10 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|