C21H33ClO2 — CID 24749827
[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenyl] carbonochloridate (PubChem CID 24749827) has the molecular formula C21H33ClO2 and a molecular weight of 352.95 g/mol. Its IUPAC name is [(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenyl] carbonochloridate.
| Compound Name | [(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenyl] carbonochloridate |
|---|---|
| PubChem CID | 24749827 |
| Molecular Formula | C21H33ClO2 |
| Molecular Weight | 352.95 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | [(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenyl] carbonochloridate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCOC(=O)Cl |
| InChI | InChI=1S/C21H33ClO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-21(22)23/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-20H2,1H3/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | BDNHZMIJSIVGCR-DOFZRALJSA-N |
| XLogP | 7.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.95 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|