C28H52O5Si2 — CID 24750336
[4-[(1S,2S,3S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2-methylbutyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 24750336) has the molecular formula C28H52O5Si2 and a molecular weight of 524.89 g/mol. Its IUPAC name is [4-[(1S,2S,3S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2-methylbutyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[(1S,2S,3S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2-methylbutyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 24750336 |
| Molecular Formula | C28H52O5Si2 |
| Molecular Weight | 524.89 g/mol |
| Exact Mass | 524.34 |
| IUPAC Name | [4-[(1S,2S,3S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2-methylbutyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | C[C@@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)c1ccc(OC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H52O5Si2/c1-20(23(29)19-31-34(11,12)27(5,6)7)24(33-35(13,14)28(8,9)10)21-15-17-22(18-16-21)32-25(30)26(2,3)4/h15-18,20,23-24,29H,19H2,1-14H3/t20-,23+,24-/m0/s1 |
| InChIKey | HISBEXBUQBKZCR-ZTCOLXNVSA-N |
| XLogP | 7.72 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.89 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|