C23H23N7O3 — CID 24750564
6-[[4-[1H-indazol-4-yl(3-methoxypropyl)amino]pyrimidin-2-yl]amino]-1,4-dihydro-3,1-benzoxazin-2-one (PubChem CID 24750564) has the molecular formula C23H23N7O3 and a molecular weight of 445.48 g/mol. Its IUPAC name is 6-[[4-[1H-indazol-4-yl(3-methoxypropyl)amino]pyrimidin-2-yl]amino]-1,4-dihydro-3,1-benzoxazin-2-one.
| Compound Name | 6-[[4-[1H-indazol-4-yl(3-methoxypropyl)amino]pyrimidin-2-yl]amino]-1,4-dihydro-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 24750564 |
| Molecular Formula | C23H23N7O3 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 6-[[4-[1H-indazol-4-yl(3-methoxypropyl)amino]pyrimidin-2-yl]amino]-1,4-dihydro-3,1-benzoxazin-2-one |
| SMILES | COCCCN(c1ccnc(Nc2ccc3c(c2)COC(=O)N3)n1)c1cccc2[nH]ncc12 |
| InChI | InChI=1S/C23H23N7O3/c1-32-11-3-10-30(20-5-2-4-19-17(20)13-25-29-19)21-8-9-24-22(28-21)26-16-6-7-18-15(12-16)14-33-23(31)27-18/h2,4-9,12-13H,3,10-11,14H2,1H3,(H,25,29)(H,27,31)(H,24,26,28) |
| InChIKey | KPIWXKNCIYLCLL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|