About (6S)-6-[[benzyl-[(2,4-difluorophenyl)methyl]amino]methyl]-3-ethyl-1,3-oxazinan-2-one
(6S)-6-[[benzyl-[(2,4-difluorophenyl)methyl]amino]methyl]-3-ethyl-1,3-oxazinan-2-one (PubChem CID 24750612) has the molecular formula C21H24F2N2O2
and a molecular weight of 374.43 g/mol. Its IUPAC name is (6S)-6-[[benzyl-[(2,4-difluorophenyl)methyl]amino]methyl]-3-ethyl-1,3-oxazinan-2-one.
Molecular Properties
| Compound Name | (6S)-6-[[benzyl-[(2,4-difluorophenyl)methyl]amino]methyl]-3-ethyl-1,3-oxazinan-2-one |
| PubChem CID | 24750612 |
| Molecular Formula | C21H24F2N2O2 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | (6S)-6-[[benzyl-[(2,4-difluorophenyl)methyl]amino]methyl]-3-ethyl-1,3-oxazinan-2-one |
| SMILES | CCN1CC[C@@H](CN(Cc2ccccc2)Cc2ccc(F)cc2F)OC1=O |
| InChI | InChI=1S/C21H24F2N2O2/c1-2-25-11-10-19(27-21(25)26)15-24(13-16-6-4-3-5-7-16)14-17-8-9-18(22)12-20(17)23/h3-9,12,19H,2,10-11,13-15H2,1H3/t19-/m0/s1 |
| InChIKey | WAMYBAKXTUJDOY-IBGZPJMESA-N |
| XLogP | 4.20 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6S)-6-[[benzyl-[(2,4-difluorophenyl)methyl]amino]methyl]-3-ethyl-1,3-oxazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-6-[[benzyl-[(2,4-difluorophenyl)methyl]amino]methyl]-3-ethyl-1,3-oxazinan-2-one?
The IUPAC name of (6S)-6-[[benzyl-[(2,4-difluorophenyl)methyl]amino]methyl]-3-ethyl-1,3-oxazinan-2-one (CID 24750612) is (6S)-6-[[benzyl-[(2,4-difluorophenyl)methyl]amino]methyl]-3-ethyl-1,3-oxazinan-2-one.
What is the SMILES notation for (6S)-6-[[benzyl-[(2,4-difluorophenyl)methyl]amino]methyl]-3-ethyl-1,3-oxazinan-2-one?
The canonical SMILES for (6S)-6-[[benzyl-[(2,4-difluorophenyl)methyl]amino]methyl]-3-ethyl-1,3-oxazinan-2-one is CCN1CC[C@@H](CN(Cc2ccccc2)Cc2ccc(F)cc2F)OC1=O.
What is the InChIKey of (6S)-6-[[benzyl-[(2,4-difluorophenyl)methyl]amino]methyl]-3-ethyl-1,3-oxazinan-2-one?
The InChIKey is WAMYBAKXTUJDOY-IBGZPJMESA-N. The full InChI is InChI=1S/C21H24F2N2O2/c1-2-25-11-10-19(27-21(25)26)15-24(13-16-6-4-3-5-7-16)14-17-8-9-18(22)12-20(17)23/h3-9,12,19H,2,10-11,13-15H2,1H3/t19-/m0/s1.
What are the key properties of (6S)-6-[[benzyl-[(2,4-difluorophenyl)methyl]amino]methyl]-3-ethyl-1,3-oxazinan-2-one?
(6S)-6-[[benzyl-[(2,4-difluorophenyl)methyl]amino]methyl]-3-ethyl-1,3-oxazinan-2-one has a molecular weight of 374.43 g/mol, XLogP of 4.20, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-6-[[benzyl-[(2,4-difluorophenyl)methyl]amino]methyl]-3-ethyl-1,3-oxazinan-2-one is sourced from PubChem (CID 24750612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).