C25H25F7N2O2 — CID 24750730
(6R,7S,8S)-2-(aminomethyl)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-2-methyl-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 24750730) has the molecular formula C25H25F7N2O2 and a molecular weight of 518.47 g/mol. Its IUPAC name is (6R,7S,8S)-2-(aminomethyl)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-2-methyl-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | (6R,7S,8S)-2-(aminomethyl)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-2-methyl-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 24750730 |
| Molecular Formula | C25H25F7N2O2 |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | (6R,7S,8S)-2-(aminomethyl)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-2-methyl-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | C[C@@H](O[C@H]1CN2C(=O)C(C)(CN)C[C@H]2[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H25F7N2O2/c1-13(15-7-16(24(27,28)29)9-17(8-15)25(30,31)32)36-20-11-34-19(10-23(2,12-33)22(34)35)21(20)14-3-5-18(26)6-4-14/h3-9,13,19-21H,10-12,33H2,1-2H3/t13-,19+,20+,21+,23?/m1/s1 |
| InChIKey | VEYAAJPRDWWIHN-RYTBDRPRSA-N |
| XLogP | 5.67 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |