C20H17N3O3 — CID 24750738
1'-[(4-ethenylphenyl)methyl]-5'-methylspiro[imidazolidine-5,3'-indole]-2,2',4-trione (PubChem CID 24750738) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is 1'-[(4-ethenylphenyl)methyl]-5'-methylspiro[imidazolidine-5,3'-indole]-2,2',4-trione.
| Compound Name | 1'-[(4-ethenylphenyl)methyl]-5'-methylspiro[imidazolidine-5,3'-indole]-2,2',4-trione |
|---|---|
| PubChem CID | 24750738 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 1'-[(4-ethenylphenyl)methyl]-5'-methylspiro[imidazolidine-5,3'-indole]-2,2',4-trione |
| SMILES | C=Cc1ccc(CN2C(=O)C3(NC(=O)NC3=O)c3cc(C)ccc32)cc1 |
| InChI | InChI=1S/C20H17N3O3/c1-3-13-5-7-14(8-6-13)11-23-16-9-4-12(2)10-15(16)20(18(23)25)17(24)21-19(26)22-20/h3-10H,1,11H2,2H3,(H2,21,22,24,26) |
| InChIKey | ZODRLLIBMMCLQU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|