C24H23F6NO2 — CID 24750889
(6R,7S,8S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(2-methylphenyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 24750889) has the molecular formula C24H23F6NO2 and a molecular weight of 471.44 g/mol. Its IUPAC name is (6R,7S,8S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(2-methylphenyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (6R,7S,8S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(2-methylphenyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 24750889 |
| Molecular Formula | C24H23F6NO2 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | (6R,7S,8S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(2-methylphenyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | Cc1ccccc1[C@@H]1[C@@H](O[C@H](C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CN2C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C24H23F6NO2/c1-13-5-3-4-6-18(13)22-19-7-8-21(32)31(19)12-20(22)33-14(2)15-9-16(23(25,26)27)11-17(10-15)24(28,29)30/h3-6,9-11,14,19-20,22H,7-8,12H2,1-2H3/t14-,19+,20+,22+/m1/s1 |
| InChIKey | DBXCTJMVOZRIGV-LKMQGSPNSA-N |
| XLogP | 6.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |