About (2S)-2-aminobutanedioic acid;4-[2-(4-methylphenyl)sulfanylphenyl]piperidine
(2S)-2-aminobutanedioic acid;4-[2-(4-methylphenyl)sulfanylphenyl]piperidine (PubChem CID 24750958) has the molecular formula C22H28N2O4S
and a molecular weight of 416.54 g/mol. Its IUPAC name is (2S)-2-aminobutanedioic acid;4-[2-(4-methylphenyl)sulfanylphenyl]piperidine.
Molecular Properties
| Compound Name | (2S)-2-aminobutanedioic acid;4-[2-(4-methylphenyl)sulfanylphenyl]piperidine |
| PubChem CID | 24750958 |
| Molecular Formula | C22H28N2O4S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (2S)-2-aminobutanedioic acid;4-[2-(4-methylphenyl)sulfanylphenyl]piperidine |
| SMILES | Cc1ccc(Sc2ccccc2C2CCNCC2)cc1.N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H21NS.C4H7NO4/c1-14-6-8-16(9-7-14)20-18-5-3-2-4-17(18)15-10-12-19-13-11-15;5-2(4(8)9)1-3(6)7/h2-9,15,19H,10-13H2,1H3;2H,1,5H2,(H,6,7)(H,8,9)/t;2-/m.0/s1 |
| InChIKey | IRVVYGZWADUSLH-WNQIDUERSA-N |
| XLogP | 3.49 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-aminobutanedioic acid;4-[2-(4-methylphenyl)sulfanylphenyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminobutanedioic acid;4-[2-(4-methylphenyl)sulfanylphenyl]piperidine?
The IUPAC name of (2S)-2-aminobutanedioic acid;4-[2-(4-methylphenyl)sulfanylphenyl]piperidine (CID 24750958) is (2S)-2-aminobutanedioic acid;4-[2-(4-methylphenyl)sulfanylphenyl]piperidine.
What is the SMILES notation for (2S)-2-aminobutanedioic acid;4-[2-(4-methylphenyl)sulfanylphenyl]piperidine?
The canonical SMILES for (2S)-2-aminobutanedioic acid;4-[2-(4-methylphenyl)sulfanylphenyl]piperidine is Cc1ccc(Sc2ccccc2C2CCNCC2)cc1.N[C@@H](CC(=O)O)C(=O)O.
What is the InChIKey of (2S)-2-aminobutanedioic acid;4-[2-(4-methylphenyl)sulfanylphenyl]piperidine?
The InChIKey is IRVVYGZWADUSLH-WNQIDUERSA-N. The full InChI is InChI=1S/C18H21NS.C4H7NO4/c1-14-6-8-16(9-7-14)20-18-5-3-2-4-17(18)15-10-12-19-13-11-15;5-2(4(8)9)1-3(6)7/h2-9,15,19H,10-13H2,1H3;2H,1,5H2,(H,6,7)(H,8,9)/t;2-/m.0/s1.
What are the key properties of (2S)-2-aminobutanedioic acid;4-[2-(4-methylphenyl)sulfanylphenyl]piperidine?
(2S)-2-aminobutanedioic acid;4-[2-(4-methylphenyl)sulfanylphenyl]piperidine has a molecular weight of 416.54 g/mol, XLogP of 3.49, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminobutanedioic acid;4-[2-(4-methylphenyl)sulfanylphenyl]piperidine is sourced from PubChem (CID 24750958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).