C13H23NO2 — CID 24751194
(E,1S,3R,5S)-N-methoxy-3-(2-methoxyethyl)-6,6-dimethylbicyclo[3.1.1]heptan-2-imine (PubChem CID 24751194) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is (E,1S,3R,5S)-N-methoxy-3-(2-methoxyethyl)-6,6-dimethylbicyclo[3.1.1]heptan-2-imine.
| Compound Name | (E,1S,3R,5S)-N-methoxy-3-(2-methoxyethyl)-6,6-dimethylbicyclo[3.1.1]heptan-2-imine |
|---|---|
| PubChem CID | 24751194 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (E,1S,3R,5S)-N-methoxy-3-(2-methoxyethyl)-6,6-dimethylbicyclo[3.1.1]heptan-2-imine |
| SMILES | COCC[C@H]1C[C@H]2C[C@H](/C1=N/OC)C2(C)C |
| InChI | InChI=1S/C13H23NO2/c1-13(2)10-7-9(5-6-15-3)12(14-16-4)11(13)8-10/h9-11H,5-8H2,1-4H3/b14-12+/t9-,10-,11+/m0/s1 |
| InChIKey | HGUPBIJCAYKKER-MTBNRICRSA-N |
| XLogP | 2.71 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|