About ethyl 5-chloro-6-[4-[(3,4-dichlorophenyl)methylcarbamoyl]piperazin-1-yl]pyridine-3-carboxylate
ethyl 5-chloro-6-[4-[(3,4-dichlorophenyl)methylcarbamoyl]piperazin-1-yl]pyridine-3-carboxylate (PubChem CID 24751576) has the molecular formula C20H21Cl3N4O3
and a molecular weight of 471.77 g/mol. Its IUPAC name is ethyl 5-chloro-6-[4-[(3,4-dichlorophenyl)methylcarbamoyl]piperazin-1-yl]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-chloro-6-[4-[(3,4-dichlorophenyl)methylcarbamoyl]piperazin-1-yl]pyridine-3-carboxylate |
| PubChem CID | 24751576 |
| Molecular Formula | C20H21Cl3N4O3 |
| Molecular Weight | 471.77 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | ethyl 5-chloro-6-[4-[(3,4-dichlorophenyl)methylcarbamoyl]piperazin-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(N2CCN(C(=O)NCc3ccc(Cl)c(Cl)c3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C20H21Cl3N4O3/c1-2-30-19(28)14-10-17(23)18(24-12-14)26-5-7-27(8-6-26)20(29)25-11-13-3-4-15(21)16(22)9-13/h3-4,9-10,12H,2,5-8,11H2,1H3,(H,25,29) |
| InChIKey | WJWSVTLNFPXFSK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.77 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-chloro-6-[4-[(3,4-dichlorophenyl)methylcarbamoyl]piperazin-1-yl]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-chloro-6-[4-[(3,4-dichlorophenyl)methylcarbamoyl]piperazin-1-yl]pyridine-3-carboxylate?
The IUPAC name of ethyl 5-chloro-6-[4-[(3,4-dichlorophenyl)methylcarbamoyl]piperazin-1-yl]pyridine-3-carboxylate (CID 24751576) is ethyl 5-chloro-6-[4-[(3,4-dichlorophenyl)methylcarbamoyl]piperazin-1-yl]pyridine-3-carboxylate.
What is the SMILES notation for ethyl 5-chloro-6-[4-[(3,4-dichlorophenyl)methylcarbamoyl]piperazin-1-yl]pyridine-3-carboxylate?
The canonical SMILES for ethyl 5-chloro-6-[4-[(3,4-dichlorophenyl)methylcarbamoyl]piperazin-1-yl]pyridine-3-carboxylate is CCOC(=O)c1cnc(N2CCN(C(=O)NCc3ccc(Cl)c(Cl)c3)CC2)c(Cl)c1.
What is the InChIKey of ethyl 5-chloro-6-[4-[(3,4-dichlorophenyl)methylcarbamoyl]piperazin-1-yl]pyridine-3-carboxylate?
The InChIKey is WJWSVTLNFPXFSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21Cl3N4O3/c1-2-30-19(28)14-10-17(23)18(24-12-14)26-5-7-27(8-6-26)20(29)25-11-13-3-4-15(21)16(22)9-13/h3-4,9-10,12H,2,5-8,11H2,1H3,(H,25,29).
What are the key properties of ethyl 5-chloro-6-[4-[(3,4-dichlorophenyl)methylcarbamoyl]piperazin-1-yl]pyridine-3-carboxylate?
ethyl 5-chloro-6-[4-[(3,4-dichlorophenyl)methylcarbamoyl]piperazin-1-yl]pyridine-3-carboxylate has a molecular weight of 471.77 g/mol, XLogP of 4.25, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-chloro-6-[4-[(3,4-dichlorophenyl)methylcarbamoyl]piperazin-1-yl]pyridine-3-carboxylate is sourced from PubChem (CID 24751576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).