C23H26N8O2S — CID 24751587
4-N-(5-aminopentyl)-2-N-(1,1-dioxo-2,3-dihydro-1,2-benzothiazol-6-yl)-4-N-(1H-indazol-4-yl)pyrimidine-2,4-diamine (PubChem CID 24751587) has the molecular formula C23H26N8O2S and a molecular weight of 478.58 g/mol. Its IUPAC name is 4-N-(5-aminopentyl)-2-N-(1,1-dioxo-2,3-dihydro-1,2-benzothiazol-6-yl)-4-N-(1H-indazol-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(5-aminopentyl)-2-N-(1,1-dioxo-2,3-dihydro-1,2-benzothiazol-6-yl)-4-N-(1H-indazol-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 24751587 |
| Molecular Formula | C23H26N8O2S |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 4-N-(5-aminopentyl)-2-N-(1,1-dioxo-2,3-dihydro-1,2-benzothiazol-6-yl)-4-N-(1H-indazol-4-yl)pyrimidine-2,4-diamine |
| SMILES | NCCCCCN(c1ccnc(Nc2ccc3c(c2)S(=O)(=O)NC3)n1)c1cccc2[nH]ncc12 |
| InChI | InChI=1S/C23H26N8O2S/c24-10-2-1-3-12-31(20-6-4-5-19-18(20)15-26-30-19)22-9-11-25-23(29-22)28-17-8-7-16-14-27-34(32,33)21(16)13-17/h4-9,11,13,15,27H,1-3,10,12,14,24H2,(H,26,30)(H,25,28,29) |
| InChIKey | XWGWDMUCLDRATC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 141.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|