C18H28O3 — CID 24751760
2-(3-hydroxy-3-methylbutyl)-5,6-dimethyl-3-(3-methylbutyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 24751760) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-(3-hydroxy-3-methylbutyl)-5,6-dimethyl-3-(3-methylbutyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(3-hydroxy-3-methylbutyl)-5,6-dimethyl-3-(3-methylbutyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 24751760 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2-(3-hydroxy-3-methylbutyl)-5,6-dimethyl-3-(3-methylbutyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(CCC(C)(C)O)=C(CCC(C)C)C1=O |
| InChI | InChI=1S/C18H28O3/c1-11(2)7-8-14-15(9-10-18(5,6)21)17(20)13(4)12(3)16(14)19/h11,21H,7-10H2,1-6H3 |
| InChIKey | QJEWTMDACSBGLT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|