About ethyl 5-chloro-6-[4-[(3,5-dinitrophenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylate
ethyl 5-chloro-6-[4-[(3,5-dinitrophenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylate (PubChem CID 24751848) has the molecular formula C19H19ClN6O7
and a molecular weight of 478.85 g/mol. Its IUPAC name is ethyl 5-chloro-6-[4-[(3,5-dinitrophenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-chloro-6-[4-[(3,5-dinitrophenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylate |
| PubChem CID | 24751848 |
| Molecular Formula | C19H19ClN6O7 |
| Molecular Weight | 478.85 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | ethyl 5-chloro-6-[4-[(3,5-dinitrophenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(N2CCN(C(=O)Nc3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C19H19ClN6O7/c1-2-33-18(27)12-7-16(20)17(21-11-12)23-3-5-24(6-4-23)19(28)22-13-8-14(25(29)30)10-15(9-13)26(31)32/h7-11H,2-6H2,1H3,(H,22,28) |
| InChIKey | WNUFUGJJWQGVCD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 161.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.85 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-chloro-6-[4-[(3,5-dinitrophenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-chloro-6-[4-[(3,5-dinitrophenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylate?
The IUPAC name of ethyl 5-chloro-6-[4-[(3,5-dinitrophenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylate (CID 24751848) is ethyl 5-chloro-6-[4-[(3,5-dinitrophenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylate.
What is the SMILES notation for ethyl 5-chloro-6-[4-[(3,5-dinitrophenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylate?
The canonical SMILES for ethyl 5-chloro-6-[4-[(3,5-dinitrophenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylate is CCOC(=O)c1cnc(N2CCN(C(=O)Nc3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)CC2)c(Cl)c1.
What is the InChIKey of ethyl 5-chloro-6-[4-[(3,5-dinitrophenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylate?
The InChIKey is WNUFUGJJWQGVCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19ClN6O7/c1-2-33-18(27)12-7-16(20)17(21-11-12)23-3-5-24(6-4-23)19(28)22-13-8-14(25(29)30)10-15(9-13)26(31)32/h7-11H,2-6H2,1H3,(H,22,28).
What are the key properties of ethyl 5-chloro-6-[4-[(3,5-dinitrophenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylate?
ethyl 5-chloro-6-[4-[(3,5-dinitrophenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylate has a molecular weight of 478.85 g/mol, XLogP of 3.08, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-chloro-6-[4-[(3,5-dinitrophenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylate is sourced from PubChem (CID 24751848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).