4-(1-benzyltriazol-4-yl)butanoic acid

C13H15N3O2 — CID 24751958

IUPAC4-(1-benzyltriazol-4-yl)butanoic acid
SMILESO=C(O)CCCc1cn(Cc2ccccc2)nn1
InChIInChI=1S/C13H15N3O2/c17-13(18)8-4-7-12-10-16(15-14-12)9-11-5-2-1-3-6-11/h1-3,5-6,10H,4,7-9H2,(H,17,18)
InChIKeyOAWCYVBOWRJWMA-UHFFFAOYSA-N
MW245.28 g/mol
LogP1.73
Rot. Bonds6

About 4-(1-benzyltriazol-4-yl)butanoic acid

4-(1-benzyltriazol-4-yl)butanoic acid (PubChem CID 24751958) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 4-(1-benzyltriazol-4-yl)butanoic acid.

Molecular Properties

Compound Name4-(1-benzyltriazol-4-yl)butanoic acid
PubChem CID24751958
Molecular FormulaC13H15N3O2
Molecular Weight245.28 g/mol
Exact Mass245.12
IUPAC Name4-(1-benzyltriazol-4-yl)butanoic acid
SMILESO=C(O)CCCc1cn(Cc2ccccc2)nn1
InChIInChI=1S/C13H15N3O2/c17-13(18)8-4-7-12-10-16(15-14-12)9-11-5-2-1-3-6-11/h1-3,5-6,10H,4,7-9H2,(H,17,18)
InChIKeyOAWCYVBOWRJWMA-UHFFFAOYSA-N
XLogP1.73
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.28
LogP ≤ 51.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-(1-benzyltriazol-4-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

9-[1-[(4-Benzoylphenyl)methyl]triazol-4-yl]nonanoic acid
CID 24789333
2-(1-benzyl-1H-1,2,3-triazol-4-yl)acetic acid
CID 24752099
9-[1-(4-Methylphenyl)triazol-4-yl]nonanoic acid
CID 24816473
4-Phenyl-1H-1,2,3-triazole-1-propanoic acid
CID 12461569
3-(1-phenyl-1H-1,2,3-triazol-4-yl)propanoic acid
CID 15619013
7-(4-Pyridin-3-yltriazol-1-yl)heptanoic acid
CID 117679617
8-(4-(Pyridin-3-yl)-1H-1,2,3-triazol-1-yl)octanoic acid
CID 117679626
3-phenyl-3-(1H-1,2,3-triazol-1-yl)propanoic acid
CID 67922199
3-[4-(3-Fluorophenyl)triazol-1-yl]propanoic acid
CID 12461570
3-[4-(3-Methylphenyl)triazol-1-yl]propanoic acid
CID 12461573
3-(5-Phenyltriazol-1-yl)propanoic acid
CID 12461579
(2S)-2-amino-3-(1-benzyltriazol-4-yl)propanoic acid
CID 15060245

Frequently Asked Questions

What is the IUPAC name of 4-(1-benzyltriazol-4-yl)butanoic acid?
The IUPAC name of 4-(1-benzyltriazol-4-yl)butanoic acid (CID 24751958) is 4-(1-benzyltriazol-4-yl)butanoic acid.
What is the SMILES notation for 4-(1-benzyltriazol-4-yl)butanoic acid?
The canonical SMILES for 4-(1-benzyltriazol-4-yl)butanoic acid is O=C(O)CCCc1cn(Cc2ccccc2)nn1.
What is the InChIKey of 4-(1-benzyltriazol-4-yl)butanoic acid?
The InChIKey is OAWCYVBOWRJWMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O2/c17-13(18)8-4-7-12-10-16(15-14-12)9-11-5-2-1-3-6-11/h1-3,5-6,10H,4,7-9H2,(H,17,18).
What are the key properties of 4-(1-benzyltriazol-4-yl)butanoic acid?
4-(1-benzyltriazol-4-yl)butanoic acid has a molecular weight of 245.28 g/mol, XLogP of 1.73, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-benzyltriazol-4-yl)butanoic acid is sourced from PubChem (CID 24751958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).