C15H26O3Si — CID 24752089
(4S,5S,7aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-1,4,5,6,7,7a-hexahydroinden-2-one (PubChem CID 24752089) has the molecular formula C15H26O3Si and a molecular weight of 282.46 g/mol. Its IUPAC name is (4S,5S,7aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-1,4,5,6,7,7a-hexahydroinden-2-one.
| Compound Name | (4S,5S,7aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-1,4,5,6,7,7a-hexahydroinden-2-one |
|---|---|
| PubChem CID | 24752089 |
| Molecular Formula | C15H26O3Si |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (4S,5S,7aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-1,4,5,6,7,7a-hexahydroinden-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H]2CC(=O)C=C2[C@@H]1O |
| InChI | InChI=1S/C15H26O3Si/c1-15(2,3)19(4,5)18-13-7-6-10-8-11(16)9-12(10)14(13)17/h9-10,13-14,17H,6-8H2,1-5H3/t10-,13-,14-/m0/s1 |
| InChIKey | LZGYLABBWKLXGL-BPNCWPANSA-N |
| XLogP | 3.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|