C22H28N5O3S+ — CID 2475226
2-[[3-[[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methyl]-1H-benzimidazol-3-ium-2-yl]amino]ethanol (PubChem CID 2475226) has the molecular formula C22H28N5O3S+ and a molecular weight of 442.57 g/mol. Its IUPAC name is 2-[[3-[[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methyl]-1H-benzimidazol-3-ium-2-yl]amino]ethanol.
| Compound Name | 2-[[3-[[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methyl]-1H-benzimidazol-3-ium-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 2475226 |
| Molecular Formula | C22H28N5O3S+ |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 2-[[3-[[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methyl]-1H-benzimidazol-3-ium-2-yl]amino]ethanol |
| SMILES | O=S(=O)(/C=C/c1ccccc1)N1CCN(C[n+]2c(NCCO)[nH]c3ccccc32)CC1 |
| InChI | InChI=1S/C22H27N5O3S/c28-16-11-23-22-24-20-8-4-5-9-21(20)27(22)18-25-12-14-26(15-13-25)31(29,30)17-10-19-6-2-1-3-7-19/h1-10,17,28H,11-16,18H2,(H,23,24)/p+1/b17-10+ |
| InChIKey | FOEMUHLMETZRKU-LICLKQGHSA-O |
| XLogP | 1.44 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|