C19H12ClF4N3O3 — CID 24752295
5'-chloro-1'-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-7'-methylspiro[imidazolidine-5,3'-indole]-2,2',4-trione (PubChem CID 24752295) has the molecular formula C19H12ClF4N3O3 and a molecular weight of 441.77 g/mol. Its IUPAC name is 5'-chloro-1'-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-7'-methylspiro[imidazolidine-5,3'-indole]-2,2',4-trione.
| Compound Name | 5'-chloro-1'-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-7'-methylspiro[imidazolidine-5,3'-indole]-2,2',4-trione |
|---|---|
| PubChem CID | 24752295 |
| Molecular Formula | C19H12ClF4N3O3 |
| Molecular Weight | 441.77 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | 5'-chloro-1'-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-7'-methylspiro[imidazolidine-5,3'-indole]-2,2',4-trione |
| SMILES | Cc1cc(Cl)cc2c1N(Cc1ccc(C(F)(F)F)cc1F)C(=O)C21NC(=O)NC1=O |
| InChI | InChI=1S/C19H12ClF4N3O3/c1-8-4-11(20)6-12-14(8)27(16(29)18(12)15(28)25-17(30)26-18)7-9-2-3-10(5-13(9)21)19(22,23)24/h2-6H,7H2,1H3,(H2,25,26,28,30) |
| InChIKey | KSQBODFRAOPJSU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.77 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|