C15H17N3O3 — CID 24752578
1'-(3-methylbutyl)spiro[imidazolidine-5,3'-indole]-2,2',4-trione (PubChem CID 24752578) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 1'-(3-methylbutyl)spiro[imidazolidine-5,3'-indole]-2,2',4-trione.
| Compound Name | 1'-(3-methylbutyl)spiro[imidazolidine-5,3'-indole]-2,2',4-trione |
|---|---|
| PubChem CID | 24752578 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1'-(3-methylbutyl)spiro[imidazolidine-5,3'-indole]-2,2',4-trione |
| SMILES | CC(C)CCN1C(=O)C2(NC(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C15H17N3O3/c1-9(2)7-8-18-11-6-4-3-5-10(11)15(13(18)20)12(19)16-14(21)17-15/h3-6,9H,7-8H2,1-2H3,(H2,16,17,19,21) |
| InChIKey | WXVPHLJDXPPKPI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|