About N-(3,4-dimethylphenyl)-1-propylpyrazolo[3,4-d]pyrimidin-4-amine
N-(3,4-dimethylphenyl)-1-propylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 2475280) has the molecular formula C16H19N5
and a molecular weight of 281.36 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-1-propylpyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-(3,4-dimethylphenyl)-1-propylpyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 2475280 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N-(3,4-dimethylphenyl)-1-propylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCCn1ncc2c(Nc3ccc(C)c(C)c3)ncnc21 |
| InChI | InChI=1S/C16H19N5/c1-4-7-21-16-14(9-19-21)15(17-10-18-16)20-13-6-5-11(2)12(3)8-13/h5-6,8-10H,4,7H2,1-3H3,(H,17,18,20) |
| InChIKey | KWZRYRNXGKAAFQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3,4-dimethylphenyl)-1-propylpyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethylphenyl)-1-propylpyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of N-(3,4-dimethylphenyl)-1-propylpyrazolo[3,4-d]pyrimidin-4-amine (CID 2475280) is N-(3,4-dimethylphenyl)-1-propylpyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for N-(3,4-dimethylphenyl)-1-propylpyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for N-(3,4-dimethylphenyl)-1-propylpyrazolo[3,4-d]pyrimidin-4-amine is CCCn1ncc2c(Nc3ccc(C)c(C)c3)ncnc21.
What is the InChIKey of N-(3,4-dimethylphenyl)-1-propylpyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is KWZRYRNXGKAAFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N5/c1-4-7-21-16-14(9-19-21)15(17-10-18-16)20-13-6-5-11(2)12(3)8-13/h5-6,8-10H,4,7H2,1-3H3,(H,17,18,20).
What are the key properties of N-(3,4-dimethylphenyl)-1-propylpyrazolo[3,4-d]pyrimidin-4-amine?
N-(3,4-dimethylphenyl)-1-propylpyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 281.36 g/mol, XLogP of 3.60, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethylphenyl)-1-propylpyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 2475280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).