C18H26N2O — CID 24752966
1-(cyclohexylmethyl)-4-[(1S)-1-phenylethyl]imidazolidin-2-one (PubChem CID 24752966) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-4-[(1S)-1-phenylethyl]imidazolidin-2-one.
| Compound Name | 1-(cyclohexylmethyl)-4-[(1S)-1-phenylethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 24752966 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 1-(cyclohexylmethyl)-4-[(1S)-1-phenylethyl]imidazolidin-2-one |
| SMILES | C[C@@H](c1ccccc1)C1CN(CC2CCCCC2)C(=O)N1 |
| InChI | InChI=1S/C18H26N2O/c1-14(16-10-6-3-7-11-16)17-13-20(18(21)19-17)12-15-8-4-2-5-9-15/h3,6-7,10-11,14-15,17H,2,4-5,8-9,12-13H2,1H3,(H,19,21)/t14-,17?/m0/s1 |
| InChIKey | URVGQRJURVSCGF-MBIQTGHCSA-N |
| XLogP | 3.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |