C20H19F2N5O3 — CID 24753198
5-amino-1-cyclopropyl-6,8-difluoro-4-oxo-7-[2-(pyridin-2-ylamino)ethylamino]quinoline-3-carboxylic acid (PubChem CID 24753198) has the molecular formula C20H19F2N5O3 and a molecular weight of 415.40 g/mol. Its IUPAC name is 5-amino-1-cyclopropyl-6,8-difluoro-4-oxo-7-[2-(pyridin-2-ylamino)ethylamino]quinoline-3-carboxylic acid.
| Compound Name | 5-amino-1-cyclopropyl-6,8-difluoro-4-oxo-7-[2-(pyridin-2-ylamino)ethylamino]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 24753198 |
| Molecular Formula | C20H19F2N5O3 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 5-amino-1-cyclopropyl-6,8-difluoro-4-oxo-7-[2-(pyridin-2-ylamino)ethylamino]quinoline-3-carboxylic acid |
| SMILES | Nc1c(F)c(NCCNc2ccccn2)c(F)c2c1c(=O)c(C(=O)O)cn2C1CC1 |
| InChI | InChI=1S/C20H19F2N5O3/c21-14-16(23)13-18(27(10-4-5-10)9-11(19(13)28)20(29)30)15(22)17(14)26-8-7-25-12-3-1-2-6-24-12/h1-3,6,9-10,26H,4-5,7-8,23H2,(H,24,25)(H,29,30) |
| InChIKey | BMBUBCPLZFMIBO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|