About 5-amino-7-(cyclohexylamino)-1-cyclopropyl-6,8-difluoroquinolin-4-one
5-amino-7-(cyclohexylamino)-1-cyclopropyl-6,8-difluoroquinolin-4-one (PubChem CID 24753288) has the molecular formula C18H21F2N3O
and a molecular weight of 333.38 g/mol. Its IUPAC name is 5-amino-7-(cyclohexylamino)-1-cyclopropyl-6,8-difluoroquinolin-4-one.
Molecular Properties
| Compound Name | 5-amino-7-(cyclohexylamino)-1-cyclopropyl-6,8-difluoroquinolin-4-one |
| PubChem CID | 24753288 |
| Molecular Formula | C18H21F2N3O |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 5-amino-7-(cyclohexylamino)-1-cyclopropyl-6,8-difluoroquinolin-4-one |
| SMILES | Nc1c(F)c(NC2CCCCC2)c(F)c2c1c(=O)ccn2C1CC1 |
| InChI | InChI=1S/C18H21F2N3O/c19-14-16(21)13-12(24)8-9-23(11-6-7-11)18(13)15(20)17(14)22-10-4-2-1-3-5-10/h8-11,22H,1-7,21H2 |
| InChIKey | DWHARRQHXVPMIA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-7-(cyclohexylamino)-1-cyclopropyl-6,8-difluoroquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-7-(cyclohexylamino)-1-cyclopropyl-6,8-difluoroquinolin-4-one?
The IUPAC name of 5-amino-7-(cyclohexylamino)-1-cyclopropyl-6,8-difluoroquinolin-4-one (CID 24753288) is 5-amino-7-(cyclohexylamino)-1-cyclopropyl-6,8-difluoroquinolin-4-one.
What is the SMILES notation for 5-amino-7-(cyclohexylamino)-1-cyclopropyl-6,8-difluoroquinolin-4-one?
The canonical SMILES for 5-amino-7-(cyclohexylamino)-1-cyclopropyl-6,8-difluoroquinolin-4-one is Nc1c(F)c(NC2CCCCC2)c(F)c2c1c(=O)ccn2C1CC1.
What is the InChIKey of 5-amino-7-(cyclohexylamino)-1-cyclopropyl-6,8-difluoroquinolin-4-one?
The InChIKey is DWHARRQHXVPMIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21F2N3O/c19-14-16(21)13-12(24)8-9-23(11-6-7-11)18(13)15(20)17(14)22-10-4-2-1-3-5-10/h8-11,22H,1-7,21H2.
What are the key properties of 5-amino-7-(cyclohexylamino)-1-cyclopropyl-6,8-difluoroquinolin-4-one?
5-amino-7-(cyclohexylamino)-1-cyclopropyl-6,8-difluoroquinolin-4-one has a molecular weight of 333.38 g/mol, XLogP of 3.94, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-7-(cyclohexylamino)-1-cyclopropyl-6,8-difluoroquinolin-4-one is sourced from PubChem (CID 24753288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).