C19H17N3O4 — CID 24753558
(3R,3aS)-8-methoxy-3-(4-nitrophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carbaldehyde (PubChem CID 24753558) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is (3R,3aS)-8-methoxy-3-(4-nitrophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carbaldehyde.
| Compound Name | (3R,3aS)-8-methoxy-3-(4-nitrophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carbaldehyde |
|---|---|
| PubChem CID | 24753558 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | (3R,3aS)-8-methoxy-3-(4-nitrophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carbaldehyde |
| SMILES | COc1ccc2c(c1)C1=NN(C=O)[C@@H](c3ccc([N+](=O)[O-])cc3)[C@@H]1CC2 |
| InChI | InChI=1S/C19H17N3O4/c1-26-15-8-4-12-5-9-16-18(17(12)10-15)20-21(11-23)19(16)13-2-6-14(7-3-13)22(24)25/h2-4,6-8,10-11,16,19H,5,9H2,1H3/t16-,19+/m1/s1 |
| InChIKey | UOZGXWGSCUVWRK-APWZRJJASA-N |
| XLogP | 3.08 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|