C17H15N3O2S — CID 24753934
5-(4-methoxyphenyl)-1'-methylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one (PubChem CID 24753934) has the molecular formula C17H15N3O2S and a molecular weight of 325.39 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-1'-methylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one.
| Compound Name | 5-(4-methoxyphenyl)-1'-methylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 24753934 |
| Molecular Formula | C17H15N3O2S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 5-(4-methoxyphenyl)-1'-methylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one |
| SMILES | COc1ccc(C2=NNC3(S2)C(=O)N(C)c2ccccc23)cc1 |
| InChI | InChI=1S/C17H15N3O2S/c1-20-14-6-4-3-5-13(14)17(16(20)21)19-18-15(23-17)11-7-9-12(22-2)10-8-11/h3-10,19H,1-2H3 |
| InChIKey | JMJRYYLNMVMZCW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_5_B(2)', 'substructure': 'N/A'} |
|---|