C22H21N3O5S2 — CID 24753974
4,6-dimethyl-3-[[3-(methylsulfamoylamino)phenyl]methyl]-7-(1,3-thiazol-2-yloxy)chromen-2-one (PubChem CID 24753974) has the molecular formula C22H21N3O5S2 and a molecular weight of 471.56 g/mol. Its IUPAC name is 4,6-dimethyl-3-[[3-(methylsulfamoylamino)phenyl]methyl]-7-(1,3-thiazol-2-yloxy)chromen-2-one.
| Compound Name | 4,6-dimethyl-3-[[3-(methylsulfamoylamino)phenyl]methyl]-7-(1,3-thiazol-2-yloxy)chromen-2-one |
|---|---|
| PubChem CID | 24753974 |
| Molecular Formula | C22H21N3O5S2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | 4,6-dimethyl-3-[[3-(methylsulfamoylamino)phenyl]methyl]-7-(1,3-thiazol-2-yloxy)chromen-2-one |
| SMILES | CNS(=O)(=O)Nc1cccc(Cc2c(C)c3cc(C)c(Oc4nccs4)cc3oc2=O)c1 |
| InChI | InChI=1S/C22H21N3O5S2/c1-13-9-17-14(2)18(11-15-5-4-6-16(10-15)25-32(27,28)23-3)21(26)29-20(17)12-19(13)30-22-24-7-8-31-22/h4-10,12,23,25H,11H2,1-3H3 |
| InChIKey | AOQPRJNTOKPJTL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|