C16H12N4O4S — CID 24754102
5'-(4-methoxyphenyl)-5-nitrospiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one (PubChem CID 24754102) has the molecular formula C16H12N4O4S and a molecular weight of 356.36 g/mol. Its IUPAC name is 5'-(4-methoxyphenyl)-5-nitrospiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one.
| Compound Name | 5'-(4-methoxyphenyl)-5-nitrospiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one |
|---|---|
| PubChem CID | 24754102 |
| Molecular Formula | C16H12N4O4S |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 5'-(4-methoxyphenyl)-5-nitrospiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one |
| SMILES | COc1ccc(C2=NNC3(S2)C(=O)Nc2ccc([N+](=O)[O-])cc23)cc1 |
| InChI | InChI=1S/C16H12N4O4S/c1-24-11-5-2-9(3-6-11)14-18-19-16(25-14)12-8-10(20(22)23)4-7-13(12)17-15(16)21/h2-8,19H,1H3,(H,17,21) |
| InChIKey | WAFLZFXMNXUNMS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_5_B(2)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|