C23H26F3N3O4S — CID 24754166
4-acetyl-N-[1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperidin-4-yl]benzenesulfonamide (PubChem CID 24754166) has the molecular formula C23H26F3N3O4S and a molecular weight of 497.54 g/mol. Its IUPAC name is 4-acetyl-N-[1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperidin-4-yl]benzenesulfonamide.
| Compound Name | 4-acetyl-N-[1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 24754166 |
| Molecular Formula | C23H26F3N3O4S |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 4-acetyl-N-[1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperidin-4-yl]benzenesulfonamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NC2CCN(C(=O)C[C@H](N)Cc3cc(F)c(F)cc3F)CC2)cc1 |
| InChI | InChI=1S/C23H26F3N3O4S/c1-14(30)15-2-4-19(5-3-15)34(32,33)28-18-6-8-29(9-7-18)23(31)12-17(27)10-16-11-21(25)22(26)13-20(16)24/h2-5,11,13,17-18,28H,6-10,12,27H2,1H3/t17-/m1/s1 |
| InChIKey | JLLGECYTOKIEAR-QGZVFWFLSA-N |
| XLogP | 2.54 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|